About 3-aminopropyl 4-bromobenzoate
3-aminopropyl 4-bromobenzoate (PubChem CID 71215851) has the molecular formula C10H12BrNO2
and a molecular weight of 258.12 g/mol. Its IUPAC name is 3-aminopropyl 4-bromobenzoate.
Molecular Properties
| Compound Name | 3-aminopropyl 4-bromobenzoate |
| PubChem CID | 71215851 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | 3-aminopropyl 4-bromobenzoate |
| SMILES | NCCCOC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H12BrNO2/c11-9-4-2-8(3-5-9)10(13)14-7-1-6-12/h2-5H,1,6-7,12H2 |
| InChIKey | GWNHYZNFAMWUQU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl 4-bromobenzoate?
The IUPAC name of 3-aminopropyl 4-bromobenzoate (CID 71215851) is 3-aminopropyl 4-bromobenzoate.
What is the SMILES notation for 3-aminopropyl 4-bromobenzoate?
The canonical SMILES for 3-aminopropyl 4-bromobenzoate is NCCCOC(=O)c1ccc(Br)cc1.
What is the InChIKey of 3-aminopropyl 4-bromobenzoate?
The InChIKey is GWNHYZNFAMWUQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO2/c11-9-4-2-8(3-5-9)10(13)14-7-1-6-12/h2-5H,1,6-7,12H2.
What are the key properties of 3-aminopropyl 4-bromobenzoate?
3-aminopropyl 4-bromobenzoate has a molecular weight of 258.12 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl 4-bromobenzoate is sourced from PubChem (CID 71215851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).