C15H21FN2 — CID 71216462
(E)-[1-[(1S)-1-(2-fluorophenyl)ethyl]-5-methylpiperidin-3-ylidene]methanamine (PubChem CID 71216462) has the molecular formula C15H21FN2 and a molecular weight of 248.35 g/mol. Its IUPAC name is (E)-[1-[(1S)-1-(2-fluorophenyl)ethyl]-5-methylpiperidin-3-ylidene]methanamine.
| Compound Name | (E)-[1-[(1S)-1-(2-fluorophenyl)ethyl]-5-methylpiperidin-3-ylidene]methanamine |
|---|---|
| PubChem CID | 71216462 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (E)-[1-[(1S)-1-(2-fluorophenyl)ethyl]-5-methylpiperidin-3-ylidene]methanamine |
| SMILES | CC1C/C(=C\N)CN([C@@H](C)c2ccccc2F)C1 |
| InChI | InChI=1S/C15H21FN2/c1-11-7-13(8-17)10-18(9-11)12(2)14-5-3-4-6-15(14)16/h3-6,8,11-12H,7,9-10,17H2,1-2H3/b13-8+/t11?,12-/m0/s1 |
| InChIKey | UEMNWWRVTRZIHE-HCSJXPLESA-N |
| XLogP | 3.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |