C33H49NO9 — CID 71216707
(2S,4S)-4-[[(3S,4S)-4-(1-butoxy-2-methyl-1-oxobutan-2-yl)-1-(2,6-diethylphenyl)-2,5-dioxopyrrolidin-3-yl]methyl]-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoic acid (PubChem CID 71216707) has the molecular formula C33H49NO9 and a molecular weight of 603.75 g/mol. Its IUPAC name is (2S,4S)-4-[[(3S,4S)-4-(1-butoxy-2-methyl-1-oxobutan-2-yl)-1-(2,6-diethylphenyl)-2,5-dioxopyrrolidin-3-yl]methyl]-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoic acid.
| Compound Name | (2S,4S)-4-[[(3S,4S)-4-(1-butoxy-2-methyl-1-oxobutan-2-yl)-1-(2,6-diethylphenyl)-2,5-dioxopyrrolidin-3-yl]methyl]-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71216707 |
| Molecular Formula | C33H49NO9 |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 603.34 |
| IUPAC Name | (2S,4S)-4-[[(3S,4S)-4-(1-butoxy-2-methyl-1-oxobutan-2-yl)-1-(2,6-diethylphenyl)-2,5-dioxopyrrolidin-3-yl]methyl]-5-(2-hydroxyethoxy)-2,4-dimethyl-5-oxopentanoic acid |
| SMILES | CCCCOC(=O)C(C)(CC)[C@H]1C(=O)N(c2c(CC)cccc2CC)C(=O)[C@H]1C[C@@](C)(C[C@H](C)C(=O)O)C(=O)OCCO |
| InChI | InChI=1S/C33H49NO9/c1-8-12-17-42-31(41)33(7,11-4)25-24(20-32(6,19-21(5)29(38)39)30(40)43-18-16-35)27(36)34(28(25)37)26-22(9-2)14-13-15-23(26)10-3/h13-15,21,24-25,35H,8-12,16-20H2,1-7H3,(H,38,39)/t21-,24-,25+,32+,33?/m0/s1 |
| InChIKey | SCQOZSSKOMDLMH-XRVOIIJZSA-N |
| XLogP | 4.72 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|