About 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one
6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one (PubChem CID 71216831) has the molecular formula C11H12ClNO2
and a molecular weight of 225.67 g/mol. Its IUPAC name is 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one.
Molecular Properties
| Compound Name | 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one |
| PubChem CID | 71216831 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one |
| SMILES | CC(C)N1C(=O)OCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C11H12ClNO2/c1-7(2)13-10-4-3-9(12)5-8(10)6-15-11(13)14/h3-5,7H,6H2,1-2H3 |
| InChIKey | LLKQVDZINBPINE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one?
The IUPAC name of 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one (CID 71216831) is 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one.
What is the SMILES notation for 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one?
The canonical SMILES for 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one is CC(C)N1C(=O)OCc2cc(Cl)ccc21.
What is the InChIKey of 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one?
The InChIKey is LLKQVDZINBPINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c1-7(2)13-10-4-3-9(12)5-8(10)6-15-11(13)14/h3-5,7H,6H2,1-2H3.
What are the key properties of 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one?
6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one has a molecular weight of 225.67 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-propan-2-yl-4H-3,1-benzoxazin-2-one is sourced from PubChem (CID 71216831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).