About CID 71216857
CID 71216857 (PubChem CID 71216857) has the molecular formula C29H23BBrN2
and a molecular weight of 490.23 g/mol.
Molecular Properties
| Compound Name | CID 71216857 |
| PubChem CID | 71216857 |
| Molecular Formula | C29H23BBrN2 |
| Molecular Weight | 490.23 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(-c2ccc(C3=NCCN=C3c3ccc(-c4ccc(Br)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H23BBrN2/c1-30-26-14-10-22(11-15-26)20-2-6-24(7-3-20)28-29(33-19-18-32-28)25-8-4-21(5-9-25)23-12-16-27(31)17-13-23/h2-17H,18-19H2,1H3 |
| InChIKey | YTWBSAAIANEABU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.23 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 71216857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71216857?
The IUPAC name of CID 71216857 (CID 71216857) is not available.
What is the SMILES notation for CID 71216857?
The canonical SMILES for CID 71216857 is C[B]c1ccc(-c2ccc(C3=NCCN=C3c3ccc(-c4ccc(Br)cc4)cc3)cc2)cc1.
What is the InChIKey of CID 71216857?
The InChIKey is YTWBSAAIANEABU-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H23BBrN2/c1-30-26-14-10-22(11-15-26)20-2-6-24(7-3-20)28-29(33-19-18-32-28)25-8-4-21(5-9-25)23-12-16-27(31)17-13-23/h2-17H,18-19H2,1H3.
What are the key properties of CID 71216857?
CID 71216857 has a molecular weight of 490.23 g/mol, XLogP of 6.45, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71216857 is sourced from PubChem (CID 71216857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).