About 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane
2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane (PubChem CID 71217161) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane.
Molecular Properties
| Compound Name | 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane |
| PubChem CID | 71217161 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane |
| SMILES | CC1C(C)C2CC1C(OC1CCCO1)C2OC1CCCO1 |
| InChI | InChI=1S/C17H28O4/c1-10-11(2)13-9-12(10)16(20-14-5-3-7-18-14)17(13)21-15-6-4-8-19-15/h10-17H,3-9H2,1-2H3 |
| InChIKey | ALSMNWCBXXCXRW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane?
The IUPAC name of 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane (CID 71217161) is 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane.
What is the SMILES notation for 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane?
The canonical SMILES for 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane is CC1C(C)C2CC1C(OC1CCCO1)C2OC1CCCO1.
What is the InChIKey of 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane?
The InChIKey is ALSMNWCBXXCXRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O4/c1-10-11(2)13-9-12(10)16(20-14-5-3-7-18-14)17(13)21-15-6-4-8-19-15/h10-17H,3-9H2,1-2H3.
What are the key properties of 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane?
2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane has a molecular weight of 296.41 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5,6-dimethyl-3-(oxolan-2-yloxy)-2-bicyclo[2.2.1]heptanyl]oxy]oxolane is sourced from PubChem (CID 71217161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).