About 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one
8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one (PubChem CID 712175) has the molecular formula C11H8N2O2S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one.
Molecular Properties
| Compound Name | 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one |
| PubChem CID | 712175 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one |
| SMILES | COc1ccc2c(c1)sc1nc(=O)ccn12 |
| InChI | InChI=1S/C11H8N2O2S/c1-15-7-2-3-8-9(6-7)16-11-12-10(14)4-5-13(8)11/h2-6H,1H3 |
| InChIKey | HHQZVPAQTWLWON-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one?
The IUPAC name of 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one (CID 712175) is 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one.
What is the SMILES notation for 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one?
The canonical SMILES for 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one is COc1ccc2c(c1)sc1nc(=O)ccn12.
What is the InChIKey of 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one?
The InChIKey is HHQZVPAQTWLWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2S/c1-15-7-2-3-8-9(6-7)16-11-12-10(14)4-5-13(8)11/h2-6H,1H3.
What are the key properties of 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one?
8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one has a molecular weight of 232.26 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one is sourced from PubChem (CID 712175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).