C11H8N2O2S — CID 712175
8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one (PubChem CID 712175) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one.
| Compound Name | 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one |
|---|---|
| PubChem CID | 712175 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 8-methoxypyrimido[2,1-b][1,3]benzothiazol-2-one |
| SMILES | COc1ccc2c(c1)sc1nc(=O)ccn12 |
| InChI | InChI=1S/C11H8N2O2S/c1-15-7-2-3-8-9(6-7)16-11-12-10(14)4-5-13(8)11/h2-6H,1H3 |
| InChIKey | HHQZVPAQTWLWON-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |