C23H22ClN3O5 — CID 71217965
2-[2-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-3-chlorofuro[3,4-b]pyridin-7-yl]-2-oxoacetic acid (PubChem CID 71217965) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is 2-[2-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-3-chlorofuro[3,4-b]pyridin-7-yl]-2-oxoacetic acid.
| Compound Name | 2-[2-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-3-chlorofuro[3,4-b]pyridin-7-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 71217965 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 2-[2-[(2R,5S)-4-benzyl-2,5-dimethylpiperazine-1-carbonyl]-3-chlorofuro[3,4-b]pyridin-7-yl]-2-oxoacetic acid |
| SMILES | C[C@@H]1CN(Cc2ccccc2)[C@@H](C)CN1C(=O)c1nc2c(C(=O)C(=O)O)occ2cc1Cl |
| InChI | InChI=1S/C23H22ClN3O5/c1-13-10-27(14(2)9-26(13)11-15-6-4-3-5-7-15)22(29)19-17(24)8-16-12-32-21(18(16)25-19)20(28)23(30)31/h3-8,12-14H,9-11H2,1-2H3,(H,30,31)/t13-,14+/m0/s1 |
| InChIKey | DSJULNCUEAKOCW-UONOGXRCSA-N |
| XLogP | 3.48 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|