About 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one
5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one (PubChem CID 71218058) has the molecular formula C16H15F2N3OS
and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one.
Molecular Properties
| Compound Name | 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one |
| PubChem CID | 71218058 |
| Molecular Formula | C16H15F2N3OS |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one |
| SMILES | Cc1c(=O)n(C(C)C)n2ccc(Sc3ccc(F)cc3F)nc12 |
| InChI | InChI=1S/C16H15F2N3OS/c1-9(2)21-16(22)10(3)15-19-14(6-7-20(15)21)23-13-5-4-11(17)8-12(13)18/h4-9H,1-3H3 |
| InChIKey | HKDZLRALFQGQHQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one?
The IUPAC name of 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one (CID 71218058) is 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one.
What is the SMILES notation for 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one?
The canonical SMILES for 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one is Cc1c(=O)n(C(C)C)n2ccc(Sc3ccc(F)cc3F)nc12.
What is the InChIKey of 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one?
The InChIKey is HKDZLRALFQGQHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15F2N3OS/c1-9(2)21-16(22)10(3)15-19-14(6-7-20(15)21)23-13-5-4-11(17)8-12(13)18/h4-9H,1-3H3.
What are the key properties of 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one?
5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one has a molecular weight of 335.38 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluorophenyl)sulfanyl-3-methyl-1-propan-2-ylpyrazolo[1,5-a]pyrimidin-2-one is sourced from PubChem (CID 71218058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).