C20H19N5O4 — CID 71218134
2-[5-(4-benzylpiperazine-1-carbonyl)-[1,2]oxazolo[4,5-b]pyridin-3-yl]-2-oxoacetamide (PubChem CID 71218134) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 2-[5-(4-benzylpiperazine-1-carbonyl)-[1,2]oxazolo[4,5-b]pyridin-3-yl]-2-oxoacetamide.
| Compound Name | 2-[5-(4-benzylpiperazine-1-carbonyl)-[1,2]oxazolo[4,5-b]pyridin-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 71218134 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 2-[5-(4-benzylpiperazine-1-carbonyl)-[1,2]oxazolo[4,5-b]pyridin-3-yl]-2-oxoacetamide |
| SMILES | NC(=O)C(=O)c1noc2ccc(C(=O)N3CCN(Cc4ccccc4)CC3)nc12 |
| InChI | InChI=1S/C20H19N5O4/c21-19(27)18(26)17-16-15(29-23-17)7-6-14(22-16)20(28)25-10-8-24(9-11-25)12-13-4-2-1-3-5-13/h1-7H,8-12H2,(H2,21,27) |
| InChIKey | GLWABWWOXIMYMD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 122.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|