C26H23N3O5 — CID 71218348
3-(4-phenoxyphenyl)-1-spiro[1,3-benzodioxole-2,4'-piperidine]-5-ylimidazolidine-2,4-dione (PubChem CID 71218348) has the molecular formula C26H23N3O5 and a molecular weight of 457.49 g/mol. Its IUPAC name is 3-(4-phenoxyphenyl)-1-spiro[1,3-benzodioxole-2,4'-piperidine]-5-ylimidazolidine-2,4-dione.
| Compound Name | 3-(4-phenoxyphenyl)-1-spiro[1,3-benzodioxole-2,4'-piperidine]-5-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 71218348 |
| Molecular Formula | C26H23N3O5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 3-(4-phenoxyphenyl)-1-spiro[1,3-benzodioxole-2,4'-piperidine]-5-ylimidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccc3c(c2)OC2(CCNCC2)O3)C(=O)N1c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23N3O5/c30-24-17-28(19-8-11-22-23(16-19)34-26(33-22)12-14-27-15-13-26)25(31)29(24)18-6-9-21(10-7-18)32-20-4-2-1-3-5-20/h1-11,16,27H,12-15,17H2 |
| InChIKey | OJKMLNJQBIKBTM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|