About 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol
5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol (PubChem CID 71218503) has the molecular formula C18H19N3O6
and a molecular weight of 373.37 g/mol. Its IUPAC name is 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol.
Molecular Properties
| Compound Name | 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol |
| PubChem CID | 71218503 |
| Molecular Formula | C18H19N3O6 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol |
| SMILES | COc1cc(-c2cnnn2-c2cc(O)cc(OC)c2OC)cc(O)c1OC |
| InChI | InChI=1S/C18H19N3O6/c1-24-15-6-10(5-14(23)18(15)27-4)13-9-19-20-21(13)12-7-11(22)8-16(25-2)17(12)26-3/h5-9,22-23H,1-4H3 |
| InChIKey | HFGRXSNLETXRCB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol?
The IUPAC name of 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol (CID 71218503) is 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol.
What is the SMILES notation for 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol?
The canonical SMILES for 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol is COc1cc(-c2cnnn2-c2cc(O)cc(OC)c2OC)cc(O)c1OC.
What is the InChIKey of 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol?
The InChIKey is HFGRXSNLETXRCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N3O6/c1-24-15-6-10(5-14(23)18(15)27-4)13-9-19-20-21(13)12-7-11(22)8-16(25-2)17(12)26-3/h5-9,22-23H,1-4H3.
What are the key properties of 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol?
5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol has a molecular weight of 373.37 g/mol, XLogP of 2.38, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(5-hydroxy-2,3-dimethoxyphenyl)triazol-4-yl]-2,3-dimethoxyphenol is sourced from PubChem (CID 71218503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).