C26H45O3P — CID 71218588
5-ethyl-5-propyl-2-(2,4,6-tritert-butylphenoxy)-1,3,2-dioxaphosphinane (PubChem CID 71218588) has the molecular formula C26H45O3P and a molecular weight of 436.62 g/mol. Its IUPAC name is 5-ethyl-5-propyl-2-(2,4,6-tritert-butylphenoxy)-1,3,2-dioxaphosphinane.
| Compound Name | 5-ethyl-5-propyl-2-(2,4,6-tritert-butylphenoxy)-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 71218588 |
| Molecular Formula | C26H45O3P |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 5-ethyl-5-propyl-2-(2,4,6-tritert-butylphenoxy)-1,3,2-dioxaphosphinane |
| SMILES | CCCC1(CC)COP(Oc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)OC1 |
| InChI | InChI=1S/C26H45O3P/c1-12-14-26(13-2)17-27-30(28-18-26)29-22-20(24(6,7)8)15-19(23(3,4)5)16-21(22)25(9,10)11/h15-16H,12-14,17-18H2,1-11H3 |
| InChIKey | CTZANFNFLMKWAW-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|