About 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole
2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole (PubChem CID 71219307) has the molecular formula C14H9BrClF3N2S
and a molecular weight of 409.66 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole |
| PubChem CID | 71219307 |
| Molecular Formula | C14H9BrClF3N2S |
| Molecular Weight | 409.66 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole |
| SMILES | FC(F)(F)C1=CN(c2ccccc2Cl)C(c2ccc(Br)s2)N1 |
| InChI | InChI=1S/C14H9BrClF3N2S/c15-12-6-5-10(22-12)13-20-11(14(17,18)19)7-21(13)9-4-2-1-3-8(9)16/h1-7,13,20H |
| InChIKey | CZVAOTIPCSFWOU-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole?
The IUPAC name of 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole (CID 71219307) is 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole.
What is the SMILES notation for 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole?
The canonical SMILES for 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole is FC(F)(F)C1=CN(c2ccccc2Cl)C(c2ccc(Br)s2)N1.
What is the InChIKey of 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole?
The InChIKey is CZVAOTIPCSFWOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrClF3N2S/c15-12-6-5-10(22-12)13-20-11(14(17,18)19)7-21(13)9-4-2-1-3-8(9)16/h1-7,13,20H.
What are the key properties of 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole?
2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole has a molecular weight of 409.66 g/mol, XLogP of 5.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromothiophen-2-yl)-3-(2-chlorophenyl)-5-(trifluoromethyl)-1,2-dihydroimidazole is sourced from PubChem (CID 71219307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).