C15H17NO2 — CID 71219985
(2R,4aS)-2-cyclohexa-1,5-dien-1-yl-1,2,4a,8a-tetrahydroquinoline-4,7-diol (PubChem CID 71219985) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is (2R,4aS)-2-cyclohexa-1,5-dien-1-yl-1,2,4a,8a-tetrahydroquinoline-4,7-diol.
| Compound Name | (2R,4aS)-2-cyclohexa-1,5-dien-1-yl-1,2,4a,8a-tetrahydroquinoline-4,7-diol |
|---|---|
| PubChem CID | 71219985 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | (2R,4aS)-2-cyclohexa-1,5-dien-1-yl-1,2,4a,8a-tetrahydroquinoline-4,7-diol |
| SMILES | OC1=CC2N[C@@H](C3=CCCC=C3)C=C(O)[C@H]2C=C1 |
| InChI | InChI=1S/C15H17NO2/c17-11-6-7-12-14(8-11)16-13(9-15(12)18)10-4-2-1-3-5-10/h2,4-9,12-14,16-18H,1,3H2/t12-,13+,14?/m0/s1 |
| InChIKey | OEZBIGCBBKJGPS-WLDKUNSKSA-N |
| XLogP | 2.67 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |