C26H37N3O5 — CID 71220177
2-(3-ethoxypropyl)-6,9-dimethoxy-N-(2-methylhexan-3-yl)-1-oxopyrazino[1,2-a]indole-3-carboxamide (PubChem CID 71220177) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2-(3-ethoxypropyl)-6,9-dimethoxy-N-(2-methylhexan-3-yl)-1-oxopyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | 2-(3-ethoxypropyl)-6,9-dimethoxy-N-(2-methylhexan-3-yl)-1-oxopyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 71220177 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 2-(3-ethoxypropyl)-6,9-dimethoxy-N-(2-methylhexan-3-yl)-1-oxopyrazino[1,2-a]indole-3-carboxamide |
| SMILES | CCCC(NC(=O)c1cn2c(cc3c(OC)ccc(OC)c32)c(=O)n1CCCOCC)C(C)C |
| InChI | InChI=1S/C26H37N3O5/c1-7-10-19(17(3)4)27-25(30)21-16-29-20(26(31)28(21)13-9-14-34-8-2)15-18-22(32-5)11-12-23(33-6)24(18)29/h11-12,15-17,19H,7-10,13-14H2,1-6H3,(H,27,30) |
| InChIKey | WEQOUOSQZMNBHT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|