About 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline
4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline (PubChem CID 71220356) has the molecular formula C11H11F3N2
and a molecular weight of 228.22 g/mol. Its IUPAC name is 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline.
Molecular Properties
| Compound Name | 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline |
| PubChem CID | 71220356 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline |
| SMILES | CC1=CCCc2nc(C(F)(F)F)nc(C)c21 |
| InChI | InChI=1S/C11H11F3N2/c1-6-4-3-5-8-9(6)7(2)15-10(16-8)11(12,13)14/h4H,3,5H2,1-2H3 |
| InChIKey | ODDFNLFQEGSWES-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline?
The IUPAC name of 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline (CID 71220356) is 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline.
What is the SMILES notation for 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline?
The canonical SMILES for 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline is CC1=CCCc2nc(C(F)(F)F)nc(C)c21.
What is the InChIKey of 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline?
The InChIKey is ODDFNLFQEGSWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N2/c1-6-4-3-5-8-9(6)7(2)15-10(16-8)11(12,13)14/h4H,3,5H2,1-2H3.
What are the key properties of 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline?
4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline has a molecular weight of 228.22 g/mol, XLogP of 3.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-2-(trifluoromethyl)-7,8-dihydroquinazoline is sourced from PubChem (CID 71220356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).