C23H26N4O5 — CID 71220649
methyl (2S)-2-[[2-[[[2-(3,4-dihydroxyphenyl)acetyl]amino]methyl]quinazolin-4-yl]amino]-3-methylbutanoate (PubChem CID 71220649) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[[[2-(3,4-dihydroxyphenyl)acetyl]amino]methyl]quinazolin-4-yl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[2-[[[2-(3,4-dihydroxyphenyl)acetyl]amino]methyl]quinazolin-4-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 71220649 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl (2S)-2-[[2-[[[2-(3,4-dihydroxyphenyl)acetyl]amino]methyl]quinazolin-4-yl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](Nc1nc(CNC(=O)Cc2ccc(O)c(O)c2)nc2ccccc12)C(C)C |
| InChI | InChI=1S/C23H26N4O5/c1-13(2)21(23(31)32-3)27-22-15-6-4-5-7-16(15)25-19(26-22)12-24-20(30)11-14-8-9-17(28)18(29)10-14/h4-10,13,21,28-29H,11-12H2,1-3H3,(H,24,30)(H,25,26,27)/t21-/m0/s1 |
| InChIKey | SHGRBHRRJSDRGE-NRFANRHFSA-N |
| XLogP | 2.51 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|