C18H26N4O3 — CID 71220689
N-[(2S,6S)-6-hydroxy-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]-N-methyl-2-(phenylcarbamoylamino)acetamide (PubChem CID 71220689) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[(2S,6S)-6-hydroxy-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]-N-methyl-2-(phenylcarbamoylamino)acetamide.
| Compound Name | N-[(2S,6S)-6-hydroxy-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]-N-methyl-2-(phenylcarbamoylamino)acetamide |
|---|---|
| PubChem CID | 71220689 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[(2S,6S)-6-hydroxy-1-methyl-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl]-N-methyl-2-(phenylcarbamoylamino)acetamide |
| SMILES | CC1C2C[C@H](O)CN2C[C@H]1N(C)C(=O)CNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H26N4O3/c1-12-15-8-14(23)10-22(15)11-16(12)21(2)17(24)9-19-18(25)20-13-6-4-3-5-7-13/h3-7,12,14-16,23H,8-11H2,1-2H3,(H2,19,20,25)/t12?,14-,15?,16+/m0/s1 |
| InChIKey | IJEFWQHOPINLGU-OMFOHFGMSA-N |
| XLogP | 0.72 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |