C12H16F3NO — CID 71221243
3,3,3-trifluoro-1-(5-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl)propan-1-one (PubChem CID 71221243) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(5-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl)propan-1-one.
| Compound Name | 3,3,3-trifluoro-1-(5-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 71221243 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 3,3,3-trifluoro-1-(5-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl)propan-1-one |
| SMILES | CC1=CCC2C1CCCN2C(=O)CC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c1-8-4-5-10-9(8)3-2-6-16(10)11(17)7-12(13,14)15/h4,9-10H,2-3,5-7H2,1H3 |
| InChIKey | DUIRGQZXIHFTDS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|