About 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole
6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole (PubChem CID 71221261) has the molecular formula C22H21BrN4O2S
and a molecular weight of 485.41 g/mol. Its IUPAC name is 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole |
| PubChem CID | 71221261 |
| Molecular Formula | C22H21BrN4O2S |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole |
| SMILES | O=S(=O)(Cc1ccc2[nH]c3ncc(Br)c(N4CCNCC4)c3c2c1)c1ccccc1 |
| InChI | InChI=1S/C22H21BrN4O2S/c23-18-13-25-22-20(21(18)27-10-8-24-9-11-27)17-12-15(6-7-19(17)26-22)14-30(28,29)16-4-2-1-3-5-16/h1-7,12-13,24H,8-11,14H2,(H,25,26) |
| InChIKey | OKIABAQNRUJLRT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole?
The IUPAC name of 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole (CID 71221261) is 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole?
The canonical SMILES for 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole is O=S(=O)(Cc1ccc2[nH]c3ncc(Br)c(N4CCNCC4)c3c2c1)c1ccccc1.
What is the InChIKey of 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole?
The InChIKey is OKIABAQNRUJLRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21BrN4O2S/c23-18-13-25-22-20(21(18)27-10-8-24-9-11-27)17-12-15(6-7-19(17)26-22)14-30(28,29)16-4-2-1-3-5-16/h1-7,12-13,24H,8-11,14H2,(H,25,26).
What are the key properties of 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole?
6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole has a molecular weight of 485.41 g/mol, XLogP of 3.86, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(benzenesulfonylmethyl)-3-bromo-4-piperazin-1-yl-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 71221261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).