About 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol
2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol (PubChem CID 71221540) has the molecular formula C18H13BrO4
and a molecular weight of 373.20 g/mol. Its IUPAC name is 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol |
| PubChem CID | 71221540 |
| Molecular Formula | C18H13BrO4 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2cccc(-c3cc(O)cc(Br)c3O)c2)c1 |
| InChI | InChI=1S/C18H13BrO4/c19-16-9-13(21)8-15(18(16)23)11-3-1-2-10(6-11)14-7-12(20)4-5-17(14)22/h1-9,20-23H |
| InChIKey | KTUWDSFFRIGDTO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
The IUPAC name of 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol (CID 71221540) is 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol.
What is the SMILES notation for 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
The canonical SMILES for 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol is Oc1ccc(O)c(-c2cccc(-c3cc(O)cc(Br)c3O)c2)c1.
What is the InChIKey of 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
The InChIKey is KTUWDSFFRIGDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13BrO4/c19-16-9-13(21)8-15(18(16)23)11-3-1-2-10(6-11)14-7-12(20)4-5-17(14)22/h1-9,20-23H.
What are the key properties of 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol?
2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol has a molecular weight of 373.20 g/mol, XLogP of 4.61, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-[3-(2,5-dihydroxyphenyl)phenyl]benzene-1,4-diol is sourced from PubChem (CID 71221540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).