C24H46O2SSi — CID 71221801
[(3aR,4S,7aS)-1-[(2R)-4-tert-butylsulfinylbutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane (PubChem CID 71221801) has the molecular formula C24H46O2SSi and a molecular weight of 426.78 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-[(2R)-4-tert-butylsulfinylbutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-[(2R)-4-tert-butylsulfinylbutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 71221801 |
| Molecular Formula | C24H46O2SSi |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | [(3aR,4S,7aS)-1-[(2R)-4-tert-butylsulfinylbutan-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)C([C@H](C)CCS(=O)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C24H46O2SSi/c1-9-28(10-2,11-3)26-22-13-12-17-24(8)20(14-15-21(22)24)19(4)16-18-27(25)23(5,6)7/h14,19,21-22H,9-13,15-18H2,1-8H3/t19-,21+,22+,24-,27?/m1/s1 |
| InChIKey | HATLTWSGBGPDGF-JMSROYIISA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|