C28H48O3SSi — CID 71221821
[(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)-4-methylpentan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane (PubChem CID 71221821) has the molecular formula C28H48O3SSi and a molecular weight of 492.84 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)-4-methylpentan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)-4-methylpentan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 71221821 |
| Molecular Formula | C28H48O3SSi |
| Molecular Weight | 492.84 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-[(2R)-4-(benzenesulfonyl)-4-methylpentan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CCC[C@]2(C)[C@@H]([C@H](C)CC(C)(C)S(=O)(=O)c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C28H48O3SSi/c1-8-33(9-2,10-3)31-26-17-14-20-28(7)24(18-19-25(26)28)22(4)21-27(5,6)32(29,30)23-15-12-11-13-16-23/h11-13,15-16,22,24-26H,8-10,14,17-21H2,1-7H3/t22-,24-,25+,26+,28-/m1/s1 |
| InChIKey | HNSGQCDUMFXFQE-JVAQIPFMSA-N |
| XLogP | 7.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.84 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|