C13H14N2O2 — CID 71221873
8-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-1-carboxamide (PubChem CID 71221873) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 8-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-1-carboxamide.
| Compound Name | 8-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-1-carboxamide |
|---|---|
| PubChem CID | 71221873 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 8-methoxy-1,2,3,4-tetrahydrocyclopenta[b]indole-1-carboxamide |
| SMILES | COc1cccc2[nH]c3c(c12)C(C(N)=O)CC3 |
| InChI | InChI=1S/C13H14N2O2/c1-17-10-4-2-3-8-12(10)11-7(13(14)16)5-6-9(11)15-8/h2-4,7,15H,5-6H2,1H3,(H2,14,16) |
| InChIKey | PZWDBWHDAWHRDS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |