C18H30N4O4 — CID 71221945
N'-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 71221945) has the molecular formula C18H30N4O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is N'-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 71221945 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N'-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC(C)C1CC(=O)N(NC(=O)C(=O)NC2CC(C)(C)NC(C)(C)C2)C1=O |
| InChI | InChI=1S/C18H30N4O4/c1-10(2)12-7-13(23)22(16(12)26)20-15(25)14(24)19-11-8-17(3,4)21-18(5,6)9-11/h10-12,21H,7-9H2,1-6H3,(H,19,24)(H,20,25) |
| InChIKey | KWMWDROKKZVWQQ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|