C19H32N4O4 — CID 71221946
N'-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 71221946) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is N'-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 71221946 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N'-(3-butan-2-yl-2,5-dioxopyrrolidin-1-yl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CCC(C)C1CC(=O)N(NC(=O)C(=O)NC2CC(C)(C)NC(C)(C)C2)C1=O |
| InChI | InChI=1S/C19H32N4O4/c1-7-11(2)13-8-14(24)23(17(13)27)21-16(26)15(25)20-12-9-18(3,4)22-19(5,6)10-12/h11-13,22H,7-10H2,1-6H3,(H,20,25)(H,21,26) |
| InChIKey | PDGGIPFXNRUKNV-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|