C25H31F3N2O3 — CID 71222176
(2S,3'R)-1-methyl-3'-[methyl(oxan-4-yl)amino]-7-(2,2,2-trifluoroacetyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one (PubChem CID 71222176) has the molecular formula C25H31F3N2O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is (2S,3'R)-1-methyl-3'-[methyl(oxan-4-yl)amino]-7-(2,2,2-trifluoroacetyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one.
| Compound Name | (2S,3'R)-1-methyl-3'-[methyl(oxan-4-yl)amino]-7-(2,2,2-trifluoroacetyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
|---|---|
| PubChem CID | 71222176 |
| Molecular Formula | C25H31F3N2O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | (2S,3'R)-1-methyl-3'-[methyl(oxan-4-yl)amino]-7-(2,2,2-trifluoroacetyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-3-one |
| SMILES | CC1C2Cc3ccc(C(=O)C(F)(F)F)cc3CN2C(=O)[C@]12CC[C@@H](N(C)C1CCOCC1)C2 |
| InChI | InChI=1S/C25H31F3N2O3/c1-15-21-12-16-3-4-17(22(31)25(26,27)28)11-18(16)14-30(21)23(32)24(15)8-5-20(13-24)29(2)19-6-9-33-10-7-19/h3-4,11,15,19-21H,5-10,12-14H2,1-2H3/t15?,20-,21?,24+/m1/s1 |
| InChIKey | KYGGTVNDQZYBHA-IKLSNFIMSA-N |
| XLogP | 3.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |