C24H30F3N3O3 — CID 71222220
(2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-9-carboxamide (PubChem CID 71222220) has the molecular formula C24H30F3N3O3 and a molecular weight of 465.52 g/mol. Its IUPAC name is (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-9-carboxamide.
| Compound Name | (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-9-carboxamide |
|---|---|
| PubChem CID | 71222220 |
| Molecular Formula | C24H30F3N3O3 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | (2S,3'R)-1-methyl-3'-(oxan-4-ylamino)-3-oxo-7-(trifluoromethyl)spiro[1,5,10,10a-tetrahydropyrrolo[1,2-b]isoquinoline-2,1'-cyclopentane]-9-carboxamide |
| SMILES | CC1C2Cc3c(cc(C(F)(F)F)cc3C(N)=O)CN2C(=O)[C@]12CC[C@@H](NC1CCOCC1)C2 |
| InChI | InChI=1S/C24H30F3N3O3/c1-13-20-10-18-14(8-15(24(25,26)27)9-19(18)21(28)31)12-30(20)22(32)23(13)5-2-17(11-23)29-16-3-6-33-7-4-16/h8-9,13,16-17,20,29H,2-7,10-12H2,1H3,(H2,28,31)/t13?,17-,20?,23+/m1/s1 |
| InChIKey | HHUTWBAPOYZWSH-GMKUWITJSA-N |
| XLogP | 3.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |