About 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride
1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride (PubChem CID 71223167) has the molecular formula C15H24ClN7O
and a molecular weight of 353.86 g/mol. Its IUPAC name is 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride.
Molecular Properties
| Compound Name | 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride |
| PubChem CID | 71223167 |
| Molecular Formula | C15H24ClN7O |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride |
| SMILES | CCNC(=O)Nc1ncnc2c1cnn2CCN1CCCCC1.Cl |
| InChI | InChI=1S/C15H23N7O.ClH/c1-2-16-15(23)20-13-12-10-19-22(14(12)18-11-17-13)9-8-21-6-4-3-5-7-21;/h10-11H,2-9H2,1H3,(H2,16,17,18,20,23);1H |
| InChIKey | YGWUWPVFHDGEMV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride?
The IUPAC name of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride (CID 71223167) is 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride.
What is the SMILES notation for 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride?
The canonical SMILES for 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride is CCNC(=O)Nc1ncnc2c1cnn2CCN1CCCCC1.Cl.
What is the InChIKey of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride?
The InChIKey is YGWUWPVFHDGEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N7O.ClH/c1-2-16-15(23)20-13-12-10-19-22(14(12)18-11-17-13)9-8-21-6-4-3-5-7-21;/h10-11H,2-9H2,1H3,(H2,16,17,18,20,23);1H.
What are the key properties of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride?
1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride has a molecular weight of 353.86 g/mol, XLogP of 1.88, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea;hydrochloride is sourced from PubChem (CID 71223167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).