About 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea
1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea (PubChem CID 71223168) has the molecular formula C15H23N7O
and a molecular weight of 317.40 g/mol. Its IUPAC name is 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea.
Molecular Properties
| Compound Name | 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea |
| PubChem CID | 71223168 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea |
| SMILES | CCNC(=O)Nc1ncnc2c1cnn2CCN1CCCCC1 |
| InChI | InChI=1S/C15H23N7O/c1-2-16-15(23)20-13-12-10-19-22(14(12)18-11-17-13)9-8-21-6-4-3-5-7-21/h10-11H,2-9H2,1H3,(H2,16,17,18,20,23) |
| InChIKey | DUVUROKKHZRURZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea?
The IUPAC name of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea (CID 71223168) is 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea.
What is the SMILES notation for 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea?
The canonical SMILES for 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea is CCNC(=O)Nc1ncnc2c1cnn2CCN1CCCCC1.
What is the InChIKey of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea?
The InChIKey is DUVUROKKHZRURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N7O/c1-2-16-15(23)20-13-12-10-19-22(14(12)18-11-17-13)9-8-21-6-4-3-5-7-21/h10-11H,2-9H2,1H3,(H2,16,17,18,20,23).
What are the key properties of 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea?
1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea has a molecular weight of 317.40 g/mol, XLogP of 1.45, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-[1-(2-piperidin-1-ylethyl)pyrazolo[3,4-d]pyrimidin-4-yl]urea is sourced from PubChem (CID 71223168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).