C28H36N2O3Si — CID 71223442
ethyl 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]imidazole-4-carboxylate (PubChem CID 71223442) has the molecular formula C28H36N2O3Si and a molecular weight of 476.69 g/mol. Its IUPAC name is ethyl 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]imidazole-4-carboxylate.
| Compound Name | ethyl 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 71223442 |
| Molecular Formula | C28H36N2O3Si |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | ethyl 1-[4-[tert-butyl(diphenyl)silyl]oxycyclohexyl]imidazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(C2CCC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C28H36N2O3Si/c1-5-32-27(31)26-20-30(21-29-26)22-16-18-23(19-17-22)33-34(28(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-15,20-23H,5,16-19H2,1-4H3 |
| InChIKey | IPKKNGRGKOVKRO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|