C16H24N4O4 — CID 712239
2-(3-nitro-2-oxo-1-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 712239) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(3-nitro-2-oxo-1-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | 2-(3-nitro-2-oxo-1-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 712239 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2-(3-nitro-2-oxo-1-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC1(C)CC(NC(=O)Cn2cccc([N+](=O)[O-])c2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C16H24N4O4/c1-15(2)8-11(9-16(3,4)18-15)17-13(21)10-19-7-5-6-12(14(19)22)20(23)24/h5-7,11,18H,8-10H2,1-4H3,(H,17,21) |
| InChIKey | CUILPTBDZLFFHZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 106.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|