C31H37N5O5 — CID 71224679
2-cyclopropyl-N-[5-[[(1R,2S,3R)-2,3-dihydroxycyclohexyl]carbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-1,3-oxazole-4-carboxamide (PubChem CID 71224679) has the molecular formula C31H37N5O5 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-cyclopropyl-N-[5-[[(1R,2S,3R)-2,3-dihydroxycyclohexyl]carbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-cyclopropyl-N-[5-[[(1R,2S,3R)-2,3-dihydroxycyclohexyl]carbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 71224679 |
| Molecular Formula | C31H37N5O5 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 2-cyclopropyl-N-[5-[[(1R,2S,3R)-2,3-dihydroxycyclohexyl]carbamoyl]-2-[4-(2-methylphenyl)piperazin-1-yl]phenyl]-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccccc1N1CCN(c2ccc(C(=O)N[C@@H]3CCC[C@@H](O)[C@H]3O)cc2NC(=O)c2coc(C3CC3)n2)CC1 |
| InChI | InChI=1S/C31H37N5O5/c1-19-5-2-3-7-25(19)35-13-15-36(16-14-35)26-12-11-21(29(39)32-22-6-4-8-27(37)28(22)38)17-23(26)33-30(40)24-18-41-31(34-24)20-9-10-20/h2-3,5,7,11-12,17-18,20,22,27-28,37-38H,4,6,8-10,13-16H2,1H3,(H,32,39)(H,33,40)/t22-,27-,28+/m1/s1 |
| InChIKey | SJZBSXDFXPRCNE-OFEZKSIWSA-N |
| XLogP | 3.44 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |