C28H38N8O3 — CID 71225007
4-amino-N-[4-[(2,2-dimethyl-3-pyrrolidin-1-ylpropanoyl)amino]cyclohexyl]-7-(2-methoxy-4-pyridinyl)pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide (PubChem CID 71225007) has the molecular formula C28H38N8O3 and a molecular weight of 534.67 g/mol. Its IUPAC name is 4-amino-N-[4-[(2,2-dimethyl-3-pyrrolidin-1-ylpropanoyl)amino]cyclohexyl]-7-(2-methoxy-4-pyridinyl)pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide.
| Compound Name | 4-amino-N-[4-[(2,2-dimethyl-3-pyrrolidin-1-ylpropanoyl)amino]cyclohexyl]-7-(2-methoxy-4-pyridinyl)pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide |
|---|---|
| PubChem CID | 71225007 |
| Molecular Formula | C28H38N8O3 |
| Molecular Weight | 534.67 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 4-amino-N-[4-[(2,2-dimethyl-3-pyrrolidin-1-ylpropanoyl)amino]cyclohexyl]-7-(2-methoxy-4-pyridinyl)pyrrolo[2,1-f][1,2,4]triazine-5-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)NC3CCC(NC(=O)C(C)(C)CN4CCCC4)CC3)c3c(N)ncnn23)ccn1 |
| InChI | InChI=1S/C28H38N8O3/c1-28(2,16-35-12-4-5-13-35)27(38)34-20-8-6-19(7-9-20)33-26(37)21-15-22(18-10-11-30-23(14-18)39-3)36-24(21)25(29)31-17-32-36/h10-11,14-15,17,19-20H,4-9,12-13,16H2,1-3H3,(H,33,37)(H,34,38)(H2,29,31,32) |
| InChIKey | GPNOZZOJBSSCEF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 139.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |