C23H38N6O — CID 71225970
N-[1-[4-(4-tert-butylpiperidin-1-yl)butyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 71225970) has the molecular formula C23H38N6O and a molecular weight of 414.60 g/mol. Its IUPAC name is N-[1-[4-(4-tert-butylpiperidin-1-yl)butyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[1-[4-(4-tert-butylpiperidin-1-yl)butyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71225970 |
| Molecular Formula | C23H38N6O |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | N-[1-[4-(4-tert-butylpiperidin-1-yl)butyl]pyrazolo[3,4-d]pyrimidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncnc2c1cnn2CCCCN1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H38N6O/c1-22(2,3)17-9-13-28(14-10-17)11-7-8-12-29-20-18(15-26-29)19(24-16-25-20)27-21(30)23(4,5)6/h15-17H,7-14H2,1-6H3,(H,24,25,27,30) |
| InChIKey | AAHDLHPMFYUMJL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|