C18H22F3N3O — CID 71226256
[(2R,3aR,6aR)-2-amino-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone (PubChem CID 71226256) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-amino-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone.
| Compound Name | [(2R,3aR,6aR)-2-amino-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
|---|---|
| PubChem CID | 71226256 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | [(2R,3aR,6aR)-2-amino-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-[3-(trifluoromethyl)-7,8-dihydro-5H-1,6-naphthyridin-6-yl]methanone |
| SMILES | N[C@@H]1C[C@H]2CCC[C@@]2(C(=O)N2CCc3ncc(C(F)(F)F)cc3C2)C1 |
| InChI | InChI=1S/C18H22F3N3O/c19-18(20,21)13-6-11-10-24(5-3-15(11)23-9-13)16(25)17-4-1-2-12(17)7-14(22)8-17/h6,9,12,14H,1-5,7-8,10,22H2/t12-,14-,17-/m1/s1 |
| InChIKey | MCKYHFCBLMTTDB-SUYBPPKGSA-N |
| XLogP | 2.89 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |