About 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine
4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine (PubChem CID 71226340) has the molecular formula C17H24F2N6
and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine |
| PubChem CID | 71226340 |
| Molecular Formula | C17H24F2N6 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine |
| SMILES | FC1(F)CCN(c2ncnc3c2cnn3CCN2CCCCC2)CC1 |
| InChI | InChI=1S/C17H24F2N6/c18-17(19)4-8-24(9-5-17)15-14-12-22-25(16(14)21-13-20-15)11-10-23-6-2-1-3-7-23/h12-13H,1-11H2 |
| InChIKey | SRZDNGAZYBLHGC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine?
The IUPAC name of 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine (CID 71226340) is 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine is FC1(F)CCN(c2ncnc3c2cnn3CCN2CCCCC2)CC1.
What is the InChIKey of 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine?
The InChIKey is SRZDNGAZYBLHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24F2N6/c18-17(19)4-8-24(9-5-17)15-14-12-22-25(16(14)21-13-20-15)11-10-23-6-2-1-3-7-23/h12-13H,1-11H2.
What are the key properties of 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine?
4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine has a molecular weight of 350.42 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-difluoropiperidin-1-yl)-1-(2-piperidin-1-ylethyl)pyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 71226340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).