C23H32BrN3O2 — CID 71226540
[(2R,3aR,6aR)-2-[[(3S,4R)-3-methyloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-(3-bromo-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone (PubChem CID 71226540) has the molecular formula C23H32BrN3O2 and a molecular weight of 462.43 g/mol. Its IUPAC name is [(2R,3aR,6aR)-2-[[(3S,4R)-3-methyloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-(3-bromo-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone.
| Compound Name | [(2R,3aR,6aR)-2-[[(3S,4R)-3-methyloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-(3-bromo-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 71226540 |
| Molecular Formula | C23H32BrN3O2 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | [(2R,3aR,6aR)-2-[[(3S,4R)-3-methyloxan-4-yl]amino]-2,3,4,5,6,6a-hexahydro-1H-pentalen-3a-yl]-(3-bromo-7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
| SMILES | C[C@@H]1COCC[C@H]1N[C@@H]1C[C@H]2CCC[C@@]2(C(=O)N2CCc3ncc(Br)cc3C2)C1 |
| InChI | InChI=1S/C23H32BrN3O2/c1-15-14-29-8-5-20(15)26-19-10-17-3-2-6-23(17,11-19)22(28)27-7-4-21-16(13-27)9-18(24)12-25-21/h9,12,15,17,19-20,26H,2-8,10-11,13-14H2,1H3/t15-,17-,19-,20-,23-/m1/s1 |
| InChIKey | JZWFEPBCOXAXEE-XDVJFCRTSA-N |
| XLogP | 3.69 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |