C30H29F4N7O3 — CID 71226620
US9718828, Example, 395 (PubChem CID 71226620) has the molecular formula C30H29F4N7O3 and a molecular weight of 611.60 g/mol. Its IUPAC name is 4-[8-amino-3-[(3R,6S)-6-methyl-1-(3-methyloxetane-3-carbonyl)piperidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide.
| Compound Name | US9718828, Example, 395 |
|---|---|
| PubChem CID | 71226620 |
| Molecular Formula | C30H29F4N7O3 |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | 4-[8-amino-3-[(3R,6S)-6-methyl-1-(3-methyloxetane-3-carbonyl)piperidin-3-yl]imidazo[1,5-a]pyrazin-1-yl]-3-fluoro-N-[4-(trifluoromethyl)-2-pyridinyl]benzamide |
| SMILES | C[C@H]1CC[C@H](CN1C(=O)C2(COC2)C)C3=NC(=C4N3C=CN=C4N)C5=C(C=C(C=C5)C(=O)NC6=NC=CC(=C6)C(F)(F)F)F |
| InChI | InChI=1S/C30H29F4N7O3/c1-16-3-4-18(13-41(16)28(43)29(2)14-44-15-29)26-39-23(24-25(35)37-9-10-40(24)26)20-6-5-17(11-21(20)31)27(42)38-22-12-19(7-8-36-22)30(32,33)34/h5-12,16,18H,3-4,13-15H2,1-2H3,(H2,35,37)(H,36,38,42)/t16-,18+/m0/s1 |
| InChIKey | WUXCAVPIXFTUAB-FUHWJXTLSA-N |
| XLogP | 3.60 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | 1060 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |