C27H27N7O3 — CID 71226835
4-[8-amino-3-[(2S)-1-[(E)-4-methoxybut-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide (PubChem CID 71226835) has the molecular formula C27H27N7O3 and a molecular weight of 497.56 g/mol. Its IUPAC name is 4-[8-amino-3-[(2S)-1-[(E)-4-methoxybut-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-[(2S)-1-[(E)-4-methoxybut-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 71226835 |
| Molecular Formula | C27H27N7O3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 4-[8-amino-3-[(2S)-1-[(E)-4-methoxybut-2-enoyl]pyrrolidin-2-yl]imidazo[1,5-a]pyrazin-1-yl]-N-pyridin-2-ylbenzamide |
| SMILES | COC/C=C/C(=O)N1CCC[C@H]1c1nc(-c2ccc(C(=O)Nc3ccccn3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C27H27N7O3/c1-37-17-5-8-22(35)33-15-4-6-20(33)26-32-23(24-25(28)30-14-16-34(24)26)18-9-11-19(12-10-18)27(36)31-21-7-2-3-13-29-21/h2-3,5,7-14,16,20H,4,6,15,17H2,1H3,(H2,28,30)(H,29,31,36)/b8-5+/t20-/m0/s1 |
| InChIKey | CFJGZYTUQQGAKO-FKIZTMCRSA-N |
| XLogP | 3.49 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|