C12H16N2O3 — CID 71226962
2-(4-methylphenoxy)-1-(1,2,4-oxadiazinan-4-yl)ethanone (PubChem CID 71226962) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-1-(1,2,4-oxadiazinan-4-yl)ethanone.
| Compound Name | 2-(4-methylphenoxy)-1-(1,2,4-oxadiazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 71226962 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(4-methylphenoxy)-1-(1,2,4-oxadiazinan-4-yl)ethanone |
| SMILES | Cc1ccc(OCC(=O)N2CCONC2)cc1 |
| InChI | InChI=1S/C12H16N2O3/c1-10-2-4-11(5-3-10)16-8-12(15)14-6-7-17-13-9-14/h2-5,13H,6-9H2,1H3 |
| InChIKey | AWMCXVJQGKGYQD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |