C15H25NO4 — CID 71227690
(5E,10E)-8-hydroxy-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one (PubChem CID 71227690) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is (5E,10E)-8-hydroxy-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one.
| Compound Name | (5E,10E)-8-hydroxy-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one |
|---|---|
| PubChem CID | 71227690 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (5E,10E)-8-hydroxy-9-methoxy-5,7-dimethyl-1-oxa-3-azacyclotetradeca-5,10-dien-2-one |
| SMILES | COC1/C=C/CCCOC(=O)NC/C(C)=C/C(C)C1O |
| InChI | InChI=1S/C15H25NO4/c1-11-9-12(2)14(17)13(19-3)7-5-4-6-8-20-15(18)16-10-11/h5,7,9,12-14,17H,4,6,8,10H2,1-3H3,(H,16,18)/b7-5+,11-9+ |
| InChIKey | QMQWVOBGLBNUGD-JEGFTUTRSA-N |
| XLogP | 2.02 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|