C15H26N2O3 — CID 71227701
8-hydroxy-9-methoxy-5,7-dimethyl-1,3-diazacyclotetradeca-5,10-dien-2-one (PubChem CID 71227701) has the molecular formula C15H26N2O3 and a molecular weight of 282.38 g/mol. Its IUPAC name is 8-hydroxy-9-methoxy-5,7-dimethyl-1,3-diazacyclotetradeca-5,10-dien-2-one.
| Compound Name | 8-hydroxy-9-methoxy-5,7-dimethyl-1,3-diazacyclotetradeca-5,10-dien-2-one |
|---|---|
| PubChem CID | 71227701 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 8-hydroxy-9-methoxy-5,7-dimethyl-1,3-diazacyclotetradeca-5,10-dien-2-one |
| SMILES | COC1C=CCCCNC(=O)NCC(C)=CC(C)C1O |
| InChI | InChI=1S/C15H26N2O3/c1-11-9-12(2)14(18)13(20-3)7-5-4-6-8-16-15(19)17-10-11/h5,7,9,12-14,18H,4,6,8,10H2,1-3H3,(H2,16,17,19) |
| InChIKey | SWBMVZVSKFILRM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|