About N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide
N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 7122772) has the molecular formula C16H13NO5S
and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide |
| PubChem CID | 7122772 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)NCCO)ccc21 |
| InChI | InChI=1S/C16H13NO5S/c18-8-7-17-23(21,22)10-5-6-13-14(9-10)16(20)12-4-2-1-3-11(12)15(13)19/h1-6,9,17-18H,7-8H2 |
| InChIKey | SCECDYZDHPLRKY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
The IUPAC name of N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide (CID 7122772) is N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide.
What is the SMILES notation for N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
The canonical SMILES for N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide is O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)NCCO)ccc21.
What is the InChIKey of N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
The InChIKey is SCECDYZDHPLRKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5S/c18-8-7-17-23(21,22)10-5-6-13-14(9-10)16(20)12-4-2-1-3-11(12)15(13)19/h1-6,9,17-18H,7-8H2.
What are the key properties of N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide has a molecular weight of 331.35 g/mol, XLogP of 0.73, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide is sourced from PubChem (CID 7122772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).