About N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide
N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide (PubChem CID 7122773) has the molecular formula C18H17NO6S
and a molecular weight of 375.40 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide.
Molecular Properties
| Compound Name | N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide |
| PubChem CID | 7122773 |
| Molecular Formula | C18H17NO6S |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide |
| SMILES | O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)N(CCO)CCO)ccc21 |
| InChI | InChI=1S/C18H17NO6S/c20-9-7-19(8-10-21)26(24,25)12-5-6-15-16(11-12)18(23)14-4-2-1-3-13(14)17(15)22/h1-6,11,20-21H,7-10H2 |
| InChIKey | HJBWVHOKVTVLCH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
The IUPAC name of N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide (CID 7122773) is N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide.
What is the SMILES notation for N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
The canonical SMILES for N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide is O=C1c2ccccc2C(=O)c2cc(S(=O)(=O)N(CCO)CCO)ccc21.
What is the InChIKey of N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
The InChIKey is HJBWVHOKVTVLCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO6S/c20-9-7-19(8-10-21)26(24,25)12-5-6-15-16(11-12)18(23)14-4-2-1-3-13(14)17(15)22/h1-6,11,20-21H,7-10H2.
What are the key properties of N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide?
N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide has a molecular weight of 375.40 g/mol, XLogP of 0.44, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-hydroxyethyl)-9,10-dioxoanthracene-2-sulfonamide is sourced from PubChem (CID 7122773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).