About N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine
N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine (PubChem CID 71228180) has the molecular formula C23H30N2O2
and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine.
Molecular Properties
| Compound Name | N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine |
| PubChem CID | 71228180 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine |
| SMILES | CCCN(CCCc1ccc(Oc2nc3ccccc3o2)cc1)C(C)CC |
| InChI | InChI=1S/C23H30N2O2/c1-4-16-25(18(3)5-2)17-8-9-19-12-14-20(15-13-19)26-23-24-21-10-6-7-11-22(21)27-23/h6-7,10-15,18H,4-5,8-9,16-17H2,1-3H3 |
| InChIKey | VYBWTCGNPFMAIO-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine?
The IUPAC name of N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine (CID 71228180) is N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine.
What is the SMILES notation for N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine?
The canonical SMILES for N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine is CCCN(CCCc1ccc(Oc2nc3ccccc3o2)cc1)C(C)CC.
What is the InChIKey of N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine?
The InChIKey is VYBWTCGNPFMAIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O2/c1-4-16-25(18(3)5-2)17-8-9-19-12-14-20(15-13-19)26-23-24-21-10-6-7-11-22(21)27-23/h6-7,10-15,18H,4-5,8-9,16-17H2,1-3H3.
What are the key properties of N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine?
N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine has a molecular weight of 366.51 g/mol, XLogP of 6.06, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[4-(1,3-benzoxazol-2-yloxy)phenyl]propyl]-N-propylbutan-2-amine is sourced from PubChem (CID 71228180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).