C10H13N3O3S — CID 712285
N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide (PubChem CID 712285) has the molecular formula C10H13N3O3S and a molecular weight of 255.30 g/mol. Its IUPAC name is N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide.
| Compound Name | N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide |
|---|---|
| PubChem CID | 712285 |
| Molecular Formula | C10H13N3O3S |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | N,N-diethyl-2,1,3-benzoxadiazole-4-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc2nonc12 |
| InChI | InChI=1S/C10H13N3O3S/c1-3-13(4-2)17(14,15)9-7-5-6-8-10(9)12-16-11-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | OCBJGLRWDZQVFW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |