C20H22N6 — CID 712288
4-N,4-N-diphenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 712288) has the molecular formula C20H22N6 and a molecular weight of 346.44 g/mol. Its IUPAC name is 4-N,4-N-diphenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N,4-N-diphenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 712288 |
| Molecular Formula | C20H22N6 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-N,4-N-diphenyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N2CCCCC2)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C20H22N6/c21-18-22-19(25-14-8-3-9-15-25)24-20(23-18)26(16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-2,4-7,10-13H,3,8-9,14-15H2,(H2,21,22,23,24) |
| InChIKey | SWRLSFMRCDKQRT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |