C22H29N3O2 — CID 71228822
2-[8-amino-5-(2-phenylethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepin-4-yl]ethanol (PubChem CID 71228822) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[8-amino-5-(2-phenylethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepin-4-yl]ethanol.
| Compound Name | 2-[8-amino-5-(2-phenylethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepin-4-yl]ethanol |
|---|---|
| PubChem CID | 71228822 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2-[8-amino-5-(2-phenylethyl)-2,3,6,7,9,10-hexahydro-[1,4]oxazino[2,3-h][3]benzazepin-4-yl]ethanol |
| SMILES | NN1CCc2cc3c(c(CCc4ccccc4)c2CC1)N(CCO)CCO3 |
| InChI | InChI=1S/C22H29N3O2/c23-25-10-8-18-16-21-22(24(12-14-26)13-15-27-21)20(19(18)9-11-25)7-6-17-4-2-1-3-5-17/h1-5,16,26H,6-15,23H2 |
| InChIKey | PYPCZPJEPDJYPN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|